C15H20ClFN2O2 — CID 63905458
N-[(3-chloro-4-fluorophenyl)methyl]-3-piperidin-4-yloxypropanamide (PubChem CID 63905458) has the molecular formula C15H20ClFN2O2 and a molecular weight of 314.79 g/mol. Its IUPAC name is N-[(3-chloro-4-fluorophenyl)methyl]-3-piperidin-4-yloxypropanamide.
| Compound Name | N-[(3-chloro-4-fluorophenyl)methyl]-3-piperidin-4-yloxypropanamide |
|---|---|
| PubChem CID | 63905458 |
| Molecular Formula | C15H20ClFN2O2 |
| Molecular Weight | 314.79 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | N-[(3-chloro-4-fluorophenyl)methyl]-3-piperidin-4-yloxypropanamide |
| SMILES | O=C(CCOC1CCNCC1)NCc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C15H20ClFN2O2/c16-13-9-11(1-2-14(13)17)10-19-15(20)5-8-21-12-3-6-18-7-4-12/h1-2,9,12,18H,3-8,10H2,(H,19,20) |
| InChIKey | GOCHMFHKVLIEIU-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.79 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |