C16H14Cl2FNO2 — CID 60621030
N-[(3-chloro-4-fluorophenyl)methyl]-3-(4-chlorophenoxy)propanamide (PubChem CID 60621030) has the molecular formula C16H14Cl2FNO2 and a molecular weight of 342.20 g/mol. Its IUPAC name is N-[(3-chloro-4-fluorophenyl)methyl]-3-(4-chlorophenoxy)propanamide.
| Compound Name | N-[(3-chloro-4-fluorophenyl)methyl]-3-(4-chlorophenoxy)propanamide |
|---|---|
| PubChem CID | 60621030 |
| Molecular Formula | C16H14Cl2FNO2 |
| Molecular Weight | 342.20 g/mol |
| Exact Mass | 341.04 |
| IUPAC Name | N-[(3-chloro-4-fluorophenyl)methyl]-3-(4-chlorophenoxy)propanamide |
| SMILES | O=C(CCOc1ccc(Cl)cc1)NCc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C16H14Cl2FNO2/c17-12-2-4-13(5-3-12)22-8-7-16(21)20-10-11-1-6-15(19)14(18)9-11/h1-6,9H,7-8,10H2,(H,20,21) |
| InChIKey | COAKTRDLQHBKLK-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.20 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |