C16H13Cl2F2NO2 — CID 55609644
3-(3,4-dichlorophenoxy)-N-[(3,5-difluorophenyl)methyl]propanamide (PubChem CID 55609644) has the molecular formula C16H13Cl2F2NO2 and a molecular weight of 360.19 g/mol. Its IUPAC name is 3-(3,4-dichlorophenoxy)-N-[(3,5-difluorophenyl)methyl]propanamide.
| Compound Name | 3-(3,4-dichlorophenoxy)-N-[(3,5-difluorophenyl)methyl]propanamide |
|---|---|
| PubChem CID | 55609644 |
| Molecular Formula | C16H13Cl2F2NO2 |
| Molecular Weight | 360.19 g/mol |
| Exact Mass | 359.03 |
| IUPAC Name | 3-(3,4-dichlorophenoxy)-N-[(3,5-difluorophenyl)methyl]propanamide |
| SMILES | O=C(CCOc1ccc(Cl)c(Cl)c1)NCc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C16H13Cl2F2NO2/c17-14-2-1-13(8-15(14)18)23-4-3-16(22)21-9-10-5-11(19)7-12(20)6-10/h1-2,5-8H,3-4,9H2,(H,21,22) |
| InChIKey | DMZNMVVPIHMWFD-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.19 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |