C13H15ClF2N2OS — CID 114627970
N-(2-chloro-4,6-difluorophenyl)-2-piperidin-4-ylsulfanylacetamide (PubChem CID 114627970) has the molecular formula C13H15ClF2N2OS and a molecular weight of 320.79 g/mol. Its IUPAC name is N-(2-chloro-4,6-difluorophenyl)-2-piperidin-4-ylsulfanylacetamide.
| Compound Name | N-(2-chloro-4,6-difluorophenyl)-2-piperidin-4-ylsulfanylacetamide |
|---|---|
| PubChem CID | 114627970 |
| Molecular Formula | C13H15ClF2N2OS |
| Molecular Weight | 320.79 g/mol |
| Exact Mass | 320.06 |
| IUPAC Name | N-(2-chloro-4,6-difluorophenyl)-2-piperidin-4-ylsulfanylacetamide |
| SMILES | O=C(CSC1CCNCC1)Nc1c(F)cc(F)cc1Cl |
| InChI | InChI=1S/C13H15ClF2N2OS/c14-10-5-8(15)6-11(16)13(10)18-12(19)7-20-9-1-3-17-4-2-9/h5-6,9,17H,1-4,7H2,(H,18,19) |
| InChIKey | VIVRCYAFOZFKON-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.79 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |