C13H16ClFN2OS — CID 114628124
N-(2-chloro-6-fluorophenyl)-2-piperidin-4-ylsulfanylacetamide (PubChem CID 114628124) has the molecular formula C13H16ClFN2OS and a molecular weight of 302.80 g/mol. Its IUPAC name is N-(2-chloro-6-fluorophenyl)-2-piperidin-4-ylsulfanylacetamide.
| Compound Name | N-(2-chloro-6-fluorophenyl)-2-piperidin-4-ylsulfanylacetamide |
|---|---|
| PubChem CID | 114628124 |
| Molecular Formula | C13H16ClFN2OS |
| Molecular Weight | 302.80 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | N-(2-chloro-6-fluorophenyl)-2-piperidin-4-ylsulfanylacetamide |
| SMILES | O=C(CSC1CCNCC1)Nc1c(F)cccc1Cl |
| InChI | InChI=1S/C13H16ClFN2OS/c14-10-2-1-3-11(15)13(10)17-12(18)8-19-9-4-6-16-7-5-9/h1-3,9,16H,4-8H2,(H,17,18) |
| InChIKey | UYXHDDTZQLDJTA-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.80 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |