C12H16ClN3OS — CID 114627925
N-(6-chloro-3-pyridinyl)-2-piperidin-4-ylsulfanylacetamide (PubChem CID 114627925) has the molecular formula C12H16ClN3OS and a molecular weight of 285.80 g/mol. Its IUPAC name is N-(6-chloro-3-pyridinyl)-2-piperidin-4-ylsulfanylacetamide.
| Compound Name | N-(6-chloro-3-pyridinyl)-2-piperidin-4-ylsulfanylacetamide |
|---|---|
| PubChem CID | 114627925 |
| Molecular Formula | C12H16ClN3OS |
| Molecular Weight | 285.80 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | N-(6-chloro-3-pyridinyl)-2-piperidin-4-ylsulfanylacetamide |
| SMILES | O=C(CSC1CCNCC1)Nc1ccc(Cl)nc1 |
| InChI | InChI=1S/C12H16ClN3OS/c13-11-2-1-9(7-15-11)16-12(17)8-18-10-3-5-14-6-4-10/h1-2,7,10,14H,3-6,8H2,(H,16,17) |
| InChIKey | QVHHBLMZDNATFT-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.80 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|