C13H16ClN3O3S — CID 114626741
N-(4-chloro-2-nitrophenyl)-2-piperidin-4-ylsulfanylacetamide (PubChem CID 114626741) has the molecular formula C13H16ClN3O3S and a molecular weight of 329.81 g/mol. Its IUPAC name is N-(4-chloro-2-nitrophenyl)-2-piperidin-4-ylsulfanylacetamide.
| Compound Name | N-(4-chloro-2-nitrophenyl)-2-piperidin-4-ylsulfanylacetamide |
|---|---|
| PubChem CID | 114626741 |
| Molecular Formula | C13H16ClN3O3S |
| Molecular Weight | 329.81 g/mol |
| Exact Mass | 329.06 |
| IUPAC Name | N-(4-chloro-2-nitrophenyl)-2-piperidin-4-ylsulfanylacetamide |
| SMILES | O=C(CSC1CCNCC1)Nc1ccc(Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H16ClN3O3S/c14-9-1-2-11(12(7-9)17(19)20)16-13(18)8-21-10-3-5-15-6-4-10/h1-2,7,10,15H,3-6,8H2,(H,16,18) |
| InChIKey | IZAYJUCLJDMZEA-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.81 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|