C15H12Cl2N2O — CID 107676050
2-[2-(5,7-dichloro-1,3-benzoxazol-2-yl)ethyl]aniline (PubChem CID 107676050) has the molecular formula C15H12Cl2N2O and a molecular weight of 307.18 g/mol. Its IUPAC name is 2-[2-(5,7-dichloro-1,3-benzoxazol-2-yl)ethyl]aniline.
| Compound Name | 2-[2-(5,7-dichloro-1,3-benzoxazol-2-yl)ethyl]aniline |
|---|---|
| PubChem CID | 107676050 |
| Molecular Formula | C15H12Cl2N2O |
| Molecular Weight | 307.18 g/mol |
| Exact Mass | 306.03 |
| IUPAC Name | 2-[2-(5,7-dichloro-1,3-benzoxazol-2-yl)ethyl]aniline |
| SMILES | Nc1ccccc1CCc1nc2cc(Cl)cc(Cl)c2o1 |
| InChI | InChI=1S/C15H12Cl2N2O/c16-10-7-11(17)15-13(8-10)19-14(20-15)6-5-9-3-1-2-4-12(9)18/h1-4,7-8H,5-6,18H2 |
| InChIKey | MUDDQCYLNNNQPI-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.18 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|