C11H10Cl3NO — CID 107676446
5,7-dichloro-2-(4-chlorobutyl)-1,3-benzoxazole (PubChem CID 107676446) has the molecular formula C11H10Cl3NO and a molecular weight of 278.57 g/mol. Its IUPAC name is 5,7-dichloro-2-(4-chlorobutyl)-1,3-benzoxazole.
| Compound Name | 5,7-dichloro-2-(4-chlorobutyl)-1,3-benzoxazole |
|---|---|
| PubChem CID | 107676446 |
| Molecular Formula | C11H10Cl3NO |
| Molecular Weight | 278.57 g/mol |
| Exact Mass | 276.98 |
| IUPAC Name | 5,7-dichloro-2-(4-chlorobutyl)-1,3-benzoxazole |
| SMILES | ClCCCCc1nc2cc(Cl)cc(Cl)c2o1 |
| InChI | InChI=1S/C11H10Cl3NO/c12-4-2-1-3-10-15-9-6-7(13)5-8(14)11(9)16-10/h5-6H,1-4H2 |
| InChIKey | FOSOCJLPAGNJCR-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.57 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|