C8H4Br2ClNO — CID 155295915
5-bromo-2-(bromomethyl)-7-chloro-1,3-benzoxazole (PubChem CID 155295915) has the molecular formula C8H4Br2ClNO and a molecular weight of 325.39 g/mol. Its IUPAC name is 5-bromo-2-(bromomethyl)-7-chloro-1,3-benzoxazole.
| Compound Name | 5-bromo-2-(bromomethyl)-7-chloro-1,3-benzoxazole |
|---|---|
| PubChem CID | 155295915 |
| Molecular Formula | C8H4Br2ClNO |
| Molecular Weight | 325.39 g/mol |
| Exact Mass | 322.83 |
| IUPAC Name | 5-bromo-2-(bromomethyl)-7-chloro-1,3-benzoxazole |
| SMILES | Clc1cc(Br)cc2nc(CBr)oc12 |
| InChI | InChI=1S/C8H4Br2ClNO/c9-3-7-12-6-2-4(10)1-5(11)8(6)13-7/h1-2H,3H2 |
| InChIKey | NLJIEEQNZBZLGH-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.39 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|