C9H6BrCl2NO — CID 82233934
6-bromo-4,7-dichloro-2-ethyl-1,3-benzoxazole (PubChem CID 82233934) has the molecular formula C9H6BrCl2NO and a molecular weight of 294.96 g/mol. Its IUPAC name is 6-bromo-4,7-dichloro-2-ethyl-1,3-benzoxazole.
| Compound Name | 6-bromo-4,7-dichloro-2-ethyl-1,3-benzoxazole |
|---|---|
| PubChem CID | 82233934 |
| Molecular Formula | C9H6BrCl2NO |
| Molecular Weight | 294.96 g/mol |
| Exact Mass | 292.90 |
| IUPAC Name | 6-bromo-4,7-dichloro-2-ethyl-1,3-benzoxazole |
| SMILES | CCc1nc2c(Cl)cc(Br)c(Cl)c2o1 |
| InChI | InChI=1S/C9H6BrCl2NO/c1-2-6-13-8-5(11)3-4(10)7(12)9(8)14-6/h3H,2H2,1H3 |
| InChIKey | BHVLTOJIGSUJNT-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.96 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|