C9H8Cl2N2O — CID 82231354
4,6-dichloro-2-ethyl-1,3-benzoxazol-5-amine (PubChem CID 82231354) has the molecular formula C9H8Cl2N2O and a molecular weight of 231.08 g/mol. Its IUPAC name is 4,6-dichloro-2-ethyl-1,3-benzoxazol-5-amine.
| Compound Name | 4,6-dichloro-2-ethyl-1,3-benzoxazol-5-amine |
|---|---|
| PubChem CID | 82231354 |
| Molecular Formula | C9H8Cl2N2O |
| Molecular Weight | 231.08 g/mol |
| Exact Mass | 230.00 |
| IUPAC Name | 4,6-dichloro-2-ethyl-1,3-benzoxazol-5-amine |
| SMILES | CCc1nc2c(Cl)c(N)c(Cl)cc2o1 |
| InChI | InChI=1S/C9H8Cl2N2O/c1-2-6-13-9-5(14-6)3-4(10)8(12)7(9)11/h3H,2,12H2,1H3 |
| InChIKey | FBBAWGIHGQOJBS-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.08 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|