C10H11NOS — CID 142292435
2-ethyl-4-methyl-1,3-benzoxazole-6-thiol (PubChem CID 142292435) has the molecular formula C10H11NOS and a molecular weight of 193.27 g/mol. Its IUPAC name is 2-ethyl-4-methyl-1,3-benzoxazole-6-thiol.
| Compound Name | 2-ethyl-4-methyl-1,3-benzoxazole-6-thiol |
|---|---|
| PubChem CID | 142292435 |
| Molecular Formula | C10H11NOS |
| Molecular Weight | 193.27 g/mol |
| Exact Mass | 193.06 |
| IUPAC Name | 2-ethyl-4-methyl-1,3-benzoxazole-6-thiol |
| SMILES | CCc1nc2c(C)cc(S)cc2o1 |
| InChI | InChI=1S/C10H11NOS/c1-3-9-11-10-6(2)4-7(13)5-8(10)12-9/h4-5,13H,3H2,1-2H3 |
| InChIKey | KDBYWTKHFXIEGA-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 26.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.27 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|