C9H9FN2O — CID 178076607
2-ethyl-4-fluoro-1,3-benzoxazol-6-amine (PubChem CID 178076607) has the molecular formula C9H9FN2O and a molecular weight of 180.18 g/mol. Its IUPAC name is 2-ethyl-4-fluoro-1,3-benzoxazol-6-amine.
| Compound Name | 2-ethyl-4-fluoro-1,3-benzoxazol-6-amine |
|---|---|
| PubChem CID | 178076607 |
| Molecular Formula | C9H9FN2O |
| Molecular Weight | 180.18 g/mol |
| Exact Mass | 180.07 |
| IUPAC Name | 2-ethyl-4-fluoro-1,3-benzoxazol-6-amine |
| SMILES | CCc1nc2c(F)cc(N)cc2o1 |
| InChI | InChI=1S/C9H9FN2O/c1-2-8-12-9-6(10)3-5(11)4-7(9)13-8/h3-4H,2,11H2,1H3 |
| InChIKey | AASKGKFHOCEBJU-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.18 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|