C17H23BFNO3 — CID 156778629
2-butyl-4-fluoro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzoxazole (PubChem CID 156778629) has the molecular formula C17H23BFNO3 and a molecular weight of 319.19 g/mol. Its IUPAC name is 2-butyl-4-fluoro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzoxazole.
| Compound Name | 2-butyl-4-fluoro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzoxazole |
|---|---|
| PubChem CID | 156778629 |
| Molecular Formula | C17H23BFNO3 |
| Molecular Weight | 319.19 g/mol |
| Exact Mass | 319.18 |
| IUPAC Name | 2-butyl-4-fluoro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzoxazole |
| SMILES | CCCCc1nc2c(F)cc(B3OC(C)(C)C(C)(C)O3)cc2o1 |
| InChI | InChI=1S/C17H23BFNO3/c1-6-7-8-14-20-15-12(19)9-11(10-13(15)21-14)18-22-16(2,3)17(4,5)23-18/h9-10H,6-8H2,1-5H3 |
| InChIKey | DETHAXHXBGKILA-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 44.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.19 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|