C15H20FNO — CID 134411036
2,6-ditert-butyl-4-fluoro-1,3-benzoxazole (PubChem CID 134411036) has the molecular formula C15H20FNO and a molecular weight of 249.33 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-fluoro-1,3-benzoxazole.
| Compound Name | 2,6-ditert-butyl-4-fluoro-1,3-benzoxazole |
|---|---|
| PubChem CID | 134411036 |
| Molecular Formula | C15H20FNO |
| Molecular Weight | 249.33 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | 2,6-ditert-butyl-4-fluoro-1,3-benzoxazole |
| SMILES | CC(C)(C)c1cc(F)c2nc(C(C)(C)C)oc2c1 |
| InChI | InChI=1S/C15H20FNO/c1-14(2,3)9-7-10(16)12-11(8-9)18-13(17-12)15(4,5)6/h7-8H,1-6H3 |
| InChIKey | VRYQTXGQRCFUGH-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.33 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |