About 2,6-ditert-butyl-4-fluoro-1,3-benzoxazole
2,6-ditert-butyl-4-fluoro-1,3-benzoxazole (PubChem CID 134411036) has the molecular formula C15H20FNO
and a molecular weight of 249.33 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-fluoro-1,3-benzoxazole.
Molecular Properties
| Compound Name | 2,6-ditert-butyl-4-fluoro-1,3-benzoxazole |
| PubChem CID | 134411036 |
| Molecular Formula | C15H20FNO |
| Molecular Weight | 249.33 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | 2,6-ditert-butyl-4-fluoro-1,3-benzoxazole |
| SMILES | CC(C)(C)c1cc(F)c2nc(C(C)(C)C)oc2c1 |
| InChI | InChI=1S/C15H20FNO/c1-14(2,3)9-7-10(16)12-11(8-9)18-13(17-12)15(4,5)6/h7-8H,1-6H3 |
| InChIKey | VRYQTXGQRCFUGH-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.33 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,6-ditert-butyl-4-fluoro-1,3-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-ditert-butyl-4-fluoro-1,3-benzoxazole?
The IUPAC name of 2,6-ditert-butyl-4-fluoro-1,3-benzoxazole (CID 134411036) is 2,6-ditert-butyl-4-fluoro-1,3-benzoxazole.
What is the SMILES notation for 2,6-ditert-butyl-4-fluoro-1,3-benzoxazole?
The canonical SMILES for 2,6-ditert-butyl-4-fluoro-1,3-benzoxazole is CC(C)(C)c1cc(F)c2nc(C(C)(C)C)oc2c1.
What is the InChIKey of 2,6-ditert-butyl-4-fluoro-1,3-benzoxazole?
The InChIKey is VRYQTXGQRCFUGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20FNO/c1-14(2,3)9-7-10(16)12-11(8-9)18-13(17-12)15(4,5)6/h7-8H,1-6H3.
What are the key properties of 2,6-ditert-butyl-4-fluoro-1,3-benzoxazole?
2,6-ditert-butyl-4-fluoro-1,3-benzoxazole has a molecular weight of 249.33 g/mol, XLogP of 4.56, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-ditert-butyl-4-fluoro-1,3-benzoxazole is sourced from PubChem (CID 134411036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).