C9H8FINO- — CID 176929490
4-fluoro-2-methyl-6-methyliodanuidyl-1,3-benzoxazole (PubChem CID 176929490) has the molecular formula C9H8FINO- and a molecular weight of 292.07 g/mol. Its IUPAC name is 4-fluoro-2-methyl-6-methyliodanuidyl-1,3-benzoxazole.
| Compound Name | 4-fluoro-2-methyl-6-methyliodanuidyl-1,3-benzoxazole |
|---|---|
| PubChem CID | 176929490 |
| Molecular Formula | C9H8FINO- |
| Molecular Weight | 292.07 g/mol |
| Exact Mass | 291.96 |
| IUPAC Name | 4-fluoro-2-methyl-6-methyliodanuidyl-1,3-benzoxazole |
| SMILES | C[I-]c1cc(F)c2nc(C)oc2c1 |
| InChI | InChI=1S/C9H8FINO/c1-5-12-9-7(10)3-6(11-2)4-8(9)13-5/h3-4H,1-2H3/q-1 |
| InChIKey | KAHOKZFUPISLRI-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.07 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|