C10H10BrNO2 — CID 175597034
1-(4-bromo-2-methyl-1,3-benzoxazol-6-yl)ethanol (PubChem CID 175597034) has the molecular formula C10H10BrNO2 and a molecular weight of 256.10 g/mol. Its IUPAC name is 1-(4-bromo-2-methyl-1,3-benzoxazol-6-yl)ethanol.
| Compound Name | 1-(4-bromo-2-methyl-1,3-benzoxazol-6-yl)ethanol |
|---|---|
| PubChem CID | 175597034 |
| Molecular Formula | C10H10BrNO2 |
| Molecular Weight | 256.10 g/mol |
| Exact Mass | 254.99 |
| IUPAC Name | 1-(4-bromo-2-methyl-1,3-benzoxazol-6-yl)ethanol |
| SMILES | Cc1nc2c(Br)cc(C(C)O)cc2o1 |
| InChI | InChI=1S/C10H10BrNO2/c1-5(13)7-3-8(11)10-9(4-7)14-6(2)12-10/h3-5,13H,1-2H3 |
| InChIKey | BQGMTVSKGVJMNX-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.10 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |