C9H10FN3 — CID 83696004
2-ethyl-7-fluoro-3H-benzimidazol-5-amine (PubChem CID 83696004) has the molecular formula C9H10FN3 and a molecular weight of 179.20 g/mol. Its IUPAC name is 2-ethyl-7-fluoro-3H-benzimidazol-5-amine.
| Compound Name | 2-ethyl-7-fluoro-3H-benzimidazol-5-amine |
|---|---|
| PubChem CID | 83696004 |
| Molecular Formula | C9H10FN3 |
| Molecular Weight | 179.20 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | 2-ethyl-7-fluoro-3H-benzimidazol-5-amine |
| SMILES | CCc1nc2c(F)cc(N)cc2[nH]1 |
| InChI | InChI=1S/C9H10FN3/c1-2-8-12-7-4-5(11)3-6(10)9(7)13-8/h3-4H,2,11H2,1H3,(H,12,13) |
| InChIKey | ATMSVRLIBOKYEG-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.20 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|