C13H17F2N3 — CID 113308599
2-(4,6-difluoro-1H-benzimidazol-2-yl)-2-ethylbutan-1-amine (PubChem CID 113308599) has the molecular formula C13H17F2N3 and a molecular weight of 253.30 g/mol. Its IUPAC name is 2-(4,6-difluoro-1H-benzimidazol-2-yl)-2-ethylbutan-1-amine.
| Compound Name | 2-(4,6-difluoro-1H-benzimidazol-2-yl)-2-ethylbutan-1-amine |
|---|---|
| PubChem CID | 113308599 |
| Molecular Formula | C13H17F2N3 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.14 |
| IUPAC Name | 2-(4,6-difluoro-1H-benzimidazol-2-yl)-2-ethylbutan-1-amine |
| SMILES | CCC(CC)(CN)c1nc2c(F)cc(F)cc2[nH]1 |
| InChI | InChI=1S/C13H17F2N3/c1-3-13(4-2,7-16)12-17-10-6-8(14)5-9(15)11(10)18-12/h5-6H,3-4,7,16H2,1-2H3,(H,17,18) |
| InChIKey | ZJAZDKAGCSGZFH-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |