C14H22N4O — CID 115430274
2-(5-ethoxy-1H-imidazo[4,5-b]pyridin-2-yl)-2-ethylbutan-1-amine (PubChem CID 115430274) has the molecular formula C14H22N4O and a molecular weight of 262.36 g/mol. Its IUPAC name is 2-(5-ethoxy-1H-imidazo[4,5-b]pyridin-2-yl)-2-ethylbutan-1-amine.
| Compound Name | 2-(5-ethoxy-1H-imidazo[4,5-b]pyridin-2-yl)-2-ethylbutan-1-amine |
|---|---|
| PubChem CID | 115430274 |
| Molecular Formula | C14H22N4O |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.18 |
| IUPAC Name | 2-(5-ethoxy-1H-imidazo[4,5-b]pyridin-2-yl)-2-ethylbutan-1-amine |
| SMILES | CCOc1ccc2[nH]c(C(CC)(CC)CN)nc2n1 |
| InChI | InChI=1S/C14H22N4O/c1-4-14(5-2,9-15)13-16-10-7-8-11(19-6-3)17-12(10)18-13/h7-8H,4-6,9,15H2,1-3H3,(H,16,17,18) |
| InChIKey | XAAXNLHYWMSKLU-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |