C11H13NO — CID 82229674
2-ethyl-5,7-dimethyl-1,3-benzoxazole (PubChem CID 82229674) has the molecular formula C11H13NO and a molecular weight of 175.23 g/mol. Its IUPAC name is 2-ethyl-5,7-dimethyl-1,3-benzoxazole.
| Compound Name | 2-ethyl-5,7-dimethyl-1,3-benzoxazole |
|---|---|
| PubChem CID | 82229674 |
| Molecular Formula | C11H13NO |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.10 |
| IUPAC Name | 2-ethyl-5,7-dimethyl-1,3-benzoxazole |
| SMILES | CCc1nc2cc(C)cc(C)c2o1 |
| InChI | InChI=1S/C11H13NO/c1-4-10-12-9-6-7(2)5-8(3)11(9)13-10/h5-6H,4H2,1-3H3 |
| InChIKey | QFGRHZXZPMYNAH-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |