C8H4BrCl2NO — CID 82233655
7-bromo-4,6-dichloro-2-methyl-1,3-benzoxazole (PubChem CID 82233655) has the molecular formula C8H4BrCl2NO and a molecular weight of 280.94 g/mol. Its IUPAC name is 7-bromo-4,6-dichloro-2-methyl-1,3-benzoxazole.
| Compound Name | 7-bromo-4,6-dichloro-2-methyl-1,3-benzoxazole |
|---|---|
| PubChem CID | 82233655 |
| Molecular Formula | C8H4BrCl2NO |
| Molecular Weight | 280.94 g/mol |
| Exact Mass | 278.89 |
| IUPAC Name | 7-bromo-4,6-dichloro-2-methyl-1,3-benzoxazole |
| SMILES | Cc1nc2c(Cl)cc(Cl)c(Br)c2o1 |
| InChI | InChI=1S/C8H4BrCl2NO/c1-3-12-7-5(11)2-4(10)6(9)8(7)13-3/h2H,1H3 |
| InChIKey | XRINFPOTTKVHAJ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.94 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|