C8H3BrCl3NO — CID 10757724
5-bromo-4,7-dichloro-2-(chloromethyl)-1,3-benzoxazole (PubChem CID 10757724) has the molecular formula C8H3BrCl3NO and a molecular weight of 315.38 g/mol. Its IUPAC name is 5-bromo-4,7-dichloro-2-(chloromethyl)-1,3-benzoxazole.
| Compound Name | 5-bromo-4,7-dichloro-2-(chloromethyl)-1,3-benzoxazole |
|---|---|
| PubChem CID | 10757724 |
| Molecular Formula | C8H3BrCl3NO |
| Molecular Weight | 315.38 g/mol |
| Exact Mass | 312.85 |
| IUPAC Name | 5-bromo-4,7-dichloro-2-(chloromethyl)-1,3-benzoxazole |
| SMILES | ClCc1nc2c(Cl)c(Br)cc(Cl)c2o1 |
| InChI | InChI=1S/C8H3BrCl3NO/c9-3-1-4(11)8-7(6(3)12)13-5(2-10)14-8/h1H,2H2 |
| InChIKey | BOOOWMYFAKREII-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.38 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|