C13H6Cl4N2O — CID 107676133
2,4-dichloro-6-(5,7-dichloro-1,3-benzoxazol-2-yl)aniline (PubChem CID 107676133) has the molecular formula C13H6Cl4N2O and a molecular weight of 348.02 g/mol. Its IUPAC name is 2,4-dichloro-6-(5,7-dichloro-1,3-benzoxazol-2-yl)aniline.
| Compound Name | 2,4-dichloro-6-(5,7-dichloro-1,3-benzoxazol-2-yl)aniline |
|---|---|
| PubChem CID | 107676133 |
| Molecular Formula | C13H6Cl4N2O |
| Molecular Weight | 348.02 g/mol |
| Exact Mass | 345.92 |
| IUPAC Name | 2,4-dichloro-6-(5,7-dichloro-1,3-benzoxazol-2-yl)aniline |
| SMILES | Nc1c(Cl)cc(Cl)cc1-c1nc2cc(Cl)cc(Cl)c2o1 |
| InChI | InChI=1S/C13H6Cl4N2O/c14-5-1-7(11(18)8(16)2-5)13-19-10-4-6(15)3-9(17)12(10)20-13/h1-4H,18H2 |
| InChIKey | VEXORDHKVSHELJ-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.02 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|