C13H7Cl2NO2 — CID 136658117
4-(5,7-dichloro-1,3-benzoxazol-2-yl)phenol (PubChem CID 136658117) has the molecular formula C13H7Cl2NO2 and a molecular weight of 280.11 g/mol. Its IUPAC name is 4-(5,7-dichloro-1,3-benzoxazol-2-yl)phenol.
| Compound Name | 4-(5,7-dichloro-1,3-benzoxazol-2-yl)phenol |
|---|---|
| PubChem CID | 136658117 |
| Molecular Formula | C13H7Cl2NO2 |
| Molecular Weight | 280.11 g/mol |
| Exact Mass | 278.99 |
| IUPAC Name | 4-(5,7-dichloro-1,3-benzoxazol-2-yl)phenol |
| SMILES | Oc1ccc(-c2nc3cc(Cl)cc(Cl)c3o2)cc1 |
| InChI | InChI=1S/C13H7Cl2NO2/c14-8-5-10(15)12-11(6-8)16-13(18-12)7-1-3-9(17)4-2-7/h1-6,17H |
| InChIKey | MJWXTQANCKAWHA-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.11 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |