About 4-(5,7-dichloro-1,3-benzoxazol-2-yl)phenol
4-(5,7-dichloro-1,3-benzoxazol-2-yl)phenol (PubChem CID 136658117) has the molecular formula C13H7Cl2NO2
and a molecular weight of 280.11 g/mol. Its IUPAC name is 4-(5,7-dichloro-1,3-benzoxazol-2-yl)phenol.
Molecular Properties
| Compound Name | 4-(5,7-dichloro-1,3-benzoxazol-2-yl)phenol |
| PubChem CID | 136658117 |
| Molecular Formula | C13H7Cl2NO2 |
| Molecular Weight | 280.11 g/mol |
| Exact Mass | 278.99 |
| IUPAC Name | 4-(5,7-dichloro-1,3-benzoxazol-2-yl)phenol |
| SMILES | Oc1ccc(-c2nc3cc(Cl)cc(Cl)c3o2)cc1 |
| InChI | InChI=1S/C13H7Cl2NO2/c14-8-5-10(15)12-11(6-8)16-13(18-12)7-1-3-9(17)4-2-7/h1-6,17H |
| InChIKey | MJWXTQANCKAWHA-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.11 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(5,7-dichloro-1,3-benzoxazol-2-yl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(5,7-dichloro-1,3-benzoxazol-2-yl)phenol?
The IUPAC name of 4-(5,7-dichloro-1,3-benzoxazol-2-yl)phenol (CID 136658117) is 4-(5,7-dichloro-1,3-benzoxazol-2-yl)phenol.
What is the SMILES notation for 4-(5,7-dichloro-1,3-benzoxazol-2-yl)phenol?
The canonical SMILES for 4-(5,7-dichloro-1,3-benzoxazol-2-yl)phenol is Oc1ccc(-c2nc3cc(Cl)cc(Cl)c3o2)cc1.
What is the InChIKey of 4-(5,7-dichloro-1,3-benzoxazol-2-yl)phenol?
The InChIKey is MJWXTQANCKAWHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H7Cl2NO2/c14-8-5-10(15)12-11(6-8)16-13(18-12)7-1-3-9(17)4-2-7/h1-6,17H.
What are the key properties of 4-(5,7-dichloro-1,3-benzoxazol-2-yl)phenol?
4-(5,7-dichloro-1,3-benzoxazol-2-yl)phenol has a molecular weight of 280.11 g/mol, XLogP of 4.51, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5,7-dichloro-1,3-benzoxazol-2-yl)phenol is sourced from PubChem (CID 136658117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).