C17H13Cl2NO3 — CID 50850175
ethyl 2-[4-(5,7-dichloro-1,3-benzoxazol-2-yl)phenyl]acetate (PubChem CID 50850175) has the molecular formula C17H13Cl2NO3 and a molecular weight of 350.20 g/mol. Its IUPAC name is ethyl 2-[4-(5,7-dichloro-1,3-benzoxazol-2-yl)phenyl]acetate.
| Compound Name | ethyl 2-[4-(5,7-dichloro-1,3-benzoxazol-2-yl)phenyl]acetate |
|---|---|
| PubChem CID | 50850175 |
| Molecular Formula | C17H13Cl2NO3 |
| Molecular Weight | 350.20 g/mol |
| Exact Mass | 349.03 |
| IUPAC Name | ethyl 2-[4-(5,7-dichloro-1,3-benzoxazol-2-yl)phenyl]acetate |
| SMILES | CCOC(=O)Cc1ccc(-c2nc3cc(Cl)cc(Cl)c3o2)cc1 |
| InChI | InChI=1S/C17H13Cl2NO3/c1-2-22-15(21)7-10-3-5-11(6-4-10)17-20-14-9-12(18)8-13(19)16(14)23-17/h3-6,8-9H,2,7H2,1H3 |
| InChIKey | KOEBITUWTGJSAU-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.20 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |