C16H15ClO2 — CID 131887311
ethyl 2-[4-(3-chlorophenyl)phenyl]acetate (PubChem CID 131887311) has the molecular formula C16H15ClO2 and a molecular weight of 274.75 g/mol. Its IUPAC name is ethyl 2-[4-(3-chlorophenyl)phenyl]acetate.
| Compound Name | ethyl 2-[4-(3-chlorophenyl)phenyl]acetate |
|---|---|
| PubChem CID | 131887311 |
| Molecular Formula | C16H15ClO2 |
| Molecular Weight | 274.75 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | ethyl 2-[4-(3-chlorophenyl)phenyl]acetate |
| SMILES | CCOC(=O)Cc1ccc(-c2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C16H15ClO2/c1-2-19-16(18)10-12-6-8-13(9-7-12)14-4-3-5-15(17)11-14/h3-9,11H,2,10H2,1H3 |
| InChIKey | XRYQBFGYDILDOL-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.75 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |