C19H22ClNO3 — CID 67208813
ethyl (2R)-3-amino-4-[4-(3-chlorophenyl)phenyl]-2-methoxybutanoate (PubChem CID 67208813) has the molecular formula C19H22ClNO3 and a molecular weight of 347.84 g/mol. Its IUPAC name is ethyl (2R)-3-amino-4-[4-(3-chlorophenyl)phenyl]-2-methoxybutanoate.
| Compound Name | ethyl (2R)-3-amino-4-[4-(3-chlorophenyl)phenyl]-2-methoxybutanoate |
|---|---|
| PubChem CID | 67208813 |
| Molecular Formula | C19H22ClNO3 |
| Molecular Weight | 347.84 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | ethyl (2R)-3-amino-4-[4-(3-chlorophenyl)phenyl]-2-methoxybutanoate |
| SMILES | CCOC(=O)[C@H](OC)C(N)Cc1ccc(-c2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C19H22ClNO3/c1-3-24-19(22)18(23-2)17(21)11-13-7-9-14(10-8-13)15-5-4-6-16(20)12-15/h4-10,12,17-18H,3,11,21H2,1-2H3/t17?,18-/m1/s1 |
| InChIKey | NTHZDBGSNJMSLR-QRWMCTBCSA-N |
| XLogP | 3.45 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.84 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |