C15H11ClN2O3 — CID 1100880
methyl 4-(5-amino-7-chloro-1,3-benzoxazol-2-yl)benzoate (PubChem CID 1100880) has the molecular formula C15H11ClN2O3 and a molecular weight of 302.72 g/mol. Its IUPAC name is methyl 4-(5-amino-7-chloro-1,3-benzoxazol-2-yl)benzoate.
| Compound Name | methyl 4-(5-amino-7-chloro-1,3-benzoxazol-2-yl)benzoate |
|---|---|
| PubChem CID | 1100880 |
| Molecular Formula | C15H11ClN2O3 |
| Molecular Weight | 302.72 g/mol |
| Exact Mass | 302.05 |
| IUPAC Name | methyl 4-(5-amino-7-chloro-1,3-benzoxazol-2-yl)benzoate |
| SMILES | COC(=O)c1ccc(-c2nc3cc(N)cc(Cl)c3o2)cc1 |
| InChI | InChI=1S/C15H11ClN2O3/c1-20-15(19)9-4-2-8(3-5-9)14-18-12-7-10(17)6-11(16)13(12)21-14/h2-7H,17H2,1H3 |
| InChIKey | NJJXYMVJOSSQDU-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.72 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|