C17H15N3O4 — CID 774869
methyl 4-(5-acetamido-6-amino-1,3-benzoxazol-2-yl)benzoate (PubChem CID 774869) has the molecular formula C17H15N3O4 and a molecular weight of 325.32 g/mol. Its IUPAC name is methyl 4-(5-acetamido-6-amino-1,3-benzoxazol-2-yl)benzoate.
| Compound Name | methyl 4-(5-acetamido-6-amino-1,3-benzoxazol-2-yl)benzoate |
|---|---|
| PubChem CID | 774869 |
| Molecular Formula | C17H15N3O4 |
| Molecular Weight | 325.32 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | methyl 4-(5-acetamido-6-amino-1,3-benzoxazol-2-yl)benzoate |
| SMILES | COC(=O)c1ccc(-c2nc3cc(NC(C)=O)c(N)cc3o2)cc1 |
| InChI | InChI=1S/C17H15N3O4/c1-9(21)19-13-8-14-15(7-12(13)18)24-16(20-14)10-3-5-11(6-4-10)17(22)23-2/h3-8H,18H2,1-2H3,(H,19,21) |
| InChIKey | HAJUMMLNBLQOJD-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 107.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.32 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|