C14H10N2O4 — CID 59831041
4-(6-amino-5-hydroxy-1,3-benzoxazol-2-yl)benzoic acid (PubChem CID 59831041) has the molecular formula C14H10N2O4 and a molecular weight of 270.24 g/mol. Its IUPAC name is 4-(6-amino-5-hydroxy-1,3-benzoxazol-2-yl)benzoic acid.
| Compound Name | 4-(6-amino-5-hydroxy-1,3-benzoxazol-2-yl)benzoic acid |
|---|---|
| PubChem CID | 59831041 |
| Molecular Formula | C14H10N2O4 |
| Molecular Weight | 270.24 g/mol |
| Exact Mass | 270.06 |
| IUPAC Name | 4-(6-amino-5-hydroxy-1,3-benzoxazol-2-yl)benzoic acid |
| SMILES | Nc1cc2oc(-c3ccc(C(=O)O)cc3)nc2cc1O |
| InChI | InChI=1S/C14H10N2O4/c15-9-5-12-10(6-11(9)17)16-13(20-12)7-1-3-8(4-2-7)14(18)19/h1-6,17H,15H2,(H,18,19) |
| InChIKey | JXNLMGYPLDMBGQ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 109.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.24 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|