C23H18N2O4 — CID 135700349
3-[[4-(5,6-dimethyl-1,3-benzoxazol-2-yl)phenyl]iminomethyl]-4-hydroxybenzoic acid (PubChem CID 135700349) has the molecular formula C23H18N2O4 and a molecular weight of 386.41 g/mol. Its IUPAC name is 3-[[4-(5,6-dimethyl-1,3-benzoxazol-2-yl)phenyl]iminomethyl]-4-hydroxybenzoic acid.
| Compound Name | 3-[[4-(5,6-dimethyl-1,3-benzoxazol-2-yl)phenyl]iminomethyl]-4-hydroxybenzoic acid |
|---|---|
| PubChem CID | 135700349 |
| Molecular Formula | C23H18N2O4 |
| Molecular Weight | 386.41 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | 3-[[4-(5,6-dimethyl-1,3-benzoxazol-2-yl)phenyl]iminomethyl]-4-hydroxybenzoic acid |
| SMILES | Cc1cc2nc(-c3ccc(/N=C/c4cc(C(=O)O)ccc4O)cc3)oc2cc1C |
| InChI | InChI=1S/C23H18N2O4/c1-13-9-19-21(10-14(13)2)29-22(25-19)15-3-6-18(7-4-15)24-12-17-11-16(23(27)28)5-8-20(17)26/h3-12,26H,1-2H3,(H,27,28)/b24-12+ |
| InChIKey | YBUJFJCBJIXNCO-WYMPLXKRSA-N |
| XLogP | 5.27 |
| TPSA | 95.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.41 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|