C15H13FN2O — CID 107273857
2-[2-(6-fluoro-1,3-benzoxazol-2-yl)ethyl]aniline (PubChem CID 107273857) has the molecular formula C15H13FN2O and a molecular weight of 256.28 g/mol. Its IUPAC name is 2-[2-(6-fluoro-1,3-benzoxazol-2-yl)ethyl]aniline.
| Compound Name | 2-[2-(6-fluoro-1,3-benzoxazol-2-yl)ethyl]aniline |
|---|---|
| PubChem CID | 107273857 |
| Molecular Formula | C15H13FN2O |
| Molecular Weight | 256.28 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | 2-[2-(6-fluoro-1,3-benzoxazol-2-yl)ethyl]aniline |
| SMILES | Nc1ccccc1CCc1nc2ccc(F)cc2o1 |
| InChI | InChI=1S/C15H13FN2O/c16-11-6-7-13-14(9-11)19-15(18-13)8-5-10-3-1-2-4-12(10)17/h1-4,6-7,9H,5,8,17H2 |
| InChIKey | OSPPUECHXBSDRJ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.28 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|