C15H14N2O2 — CID 102696273
2-[(6-methoxy-1,3-benzoxazol-2-yl)methyl]aniline (PubChem CID 102696273) has the molecular formula C15H14N2O2 and a molecular weight of 254.29 g/mol. Its IUPAC name is 2-[(6-methoxy-1,3-benzoxazol-2-yl)methyl]aniline.
| Compound Name | 2-[(6-methoxy-1,3-benzoxazol-2-yl)methyl]aniline |
|---|---|
| PubChem CID | 102696273 |
| Molecular Formula | C15H14N2O2 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | 2-[(6-methoxy-1,3-benzoxazol-2-yl)methyl]aniline |
| SMILES | COc1ccc2nc(Cc3ccccc3N)oc2c1 |
| InChI | InChI=1S/C15H14N2O2/c1-18-11-6-7-13-14(9-11)19-15(17-13)8-10-4-2-3-5-12(10)16/h2-7,9H,8,16H2,1H3 |
| InChIKey | LZGDRFARRHMHLQ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|