C9H15N3O — CID 83846636
3-(piperidin-3-ylmethyl)-1,2-oxazol-5-amine (PubChem CID 83846636) has the molecular formula C9H15N3O and a molecular weight of 181.24 g/mol. Its IUPAC name is 3-(piperidin-3-ylmethyl)-1,2-oxazol-5-amine.
| Compound Name | 3-(piperidin-3-ylmethyl)-1,2-oxazol-5-amine |
|---|---|
| PubChem CID | 83846636 |
| Molecular Formula | C9H15N3O |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.12 |
| IUPAC Name | 3-(piperidin-3-ylmethyl)-1,2-oxazol-5-amine |
| SMILES | Nc1cc(CC2CCCNC2)no1 |
| InChI | InChI=1S/C9H15N3O/c10-9-5-8(12-13-9)4-7-2-1-3-11-6-7/h5,7,11H,1-4,6,10H2 |
| InChIKey | XPTQODUPJCXKRQ-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |