C10H17N3O — CID 115083426
[2-(piperidin-3-ylmethyl)-1,3-oxazol-4-yl]methanamine (PubChem CID 115083426) has the molecular formula C10H17N3O and a molecular weight of 195.27 g/mol. Its IUPAC name is [2-(piperidin-3-ylmethyl)-1,3-oxazol-4-yl]methanamine.
| Compound Name | [2-(piperidin-3-ylmethyl)-1,3-oxazol-4-yl]methanamine |
|---|---|
| PubChem CID | 115083426 |
| Molecular Formula | C10H17N3O |
| Molecular Weight | 195.27 g/mol |
| Exact Mass | 195.14 |
| IUPAC Name | [2-(piperidin-3-ylmethyl)-1,3-oxazol-4-yl]methanamine |
| SMILES | NCc1coc(CC2CCCNC2)n1 |
| InChI | InChI=1S/C10H17N3O/c11-5-9-7-14-10(13-9)4-8-2-1-3-12-6-8/h7-8,12H,1-6,11H2 |
| InChIKey | HGPXAHJDFSIXJV-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.27 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |