C9H15N3O2 — CID 103166250
5-[(3-ethoxycyclobutyl)methyl]-1,2,4-oxadiazol-3-amine (PubChem CID 103166250) has the molecular formula C9H15N3O2 and a molecular weight of 197.24 g/mol. Its IUPAC name is 5-[(3-ethoxycyclobutyl)methyl]-1,2,4-oxadiazol-3-amine.
| Compound Name | 5-[(3-ethoxycyclobutyl)methyl]-1,2,4-oxadiazol-3-amine |
|---|---|
| PubChem CID | 103166250 |
| Molecular Formula | C9H15N3O2 |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | 5-[(3-ethoxycyclobutyl)methyl]-1,2,4-oxadiazol-3-amine |
| SMILES | CCOC1CC(Cc2nc(N)no2)C1 |
| InChI | InChI=1S/C9H15N3O2/c1-2-13-7-3-6(4-7)5-8-11-9(10)12-14-8/h6-7H,2-5H2,1H3,(H2,10,12) |
| InChIKey | WZMKYNDKHIWGMX-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |