C12H20N2O2 — CID 103164225
3-[(3-ethoxycyclobutyl)methyl]-4-ethyl-1,2-oxazol-5-amine (PubChem CID 103164225) has the molecular formula C12H20N2O2 and a molecular weight of 224.30 g/mol. Its IUPAC name is 3-[(3-ethoxycyclobutyl)methyl]-4-ethyl-1,2-oxazol-5-amine.
| Compound Name | 3-[(3-ethoxycyclobutyl)methyl]-4-ethyl-1,2-oxazol-5-amine |
|---|---|
| PubChem CID | 103164225 |
| Molecular Formula | C12H20N2O2 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.15 |
| IUPAC Name | 3-[(3-ethoxycyclobutyl)methyl]-4-ethyl-1,2-oxazol-5-amine |
| SMILES | CCOC1CC(Cc2noc(N)c2CC)C1 |
| InChI | InChI=1S/C12H20N2O2/c1-3-10-11(14-16-12(10)13)7-8-5-9(6-8)15-4-2/h8-9H,3-7,13H2,1-2H3 |
| InChIKey | FCKAEAFRZHVIDF-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |