C11H11N3O3 — CID 112632052
5-(2-anilinoethyl)-1,2,4-oxadiazole-3-carboxylic acid (PubChem CID 112632052) has the molecular formula C11H11N3O3 and a molecular weight of 233.23 g/mol. Its IUPAC name is 5-(2-anilinoethyl)-1,2,4-oxadiazole-3-carboxylic acid.
| Compound Name | 5-(2-anilinoethyl)-1,2,4-oxadiazole-3-carboxylic acid |
|---|---|
| PubChem CID | 112632052 |
| Molecular Formula | C11H11N3O3 |
| Molecular Weight | 233.23 g/mol |
| Exact Mass | 233.08 |
| IUPAC Name | 5-(2-anilinoethyl)-1,2,4-oxadiazole-3-carboxylic acid |
| SMILES | O=C(O)c1noc(CCNc2ccccc2)n1 |
| InChI | InChI=1S/C11H11N3O3/c15-11(16)10-13-9(17-14-10)6-7-12-8-4-2-1-3-5-8/h1-5,12H,6-7H2,(H,15,16) |
| InChIKey | UKYMJFDISCEUDF-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 88.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.23 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |