C15H27N3O2 — CID 101166747
N-(5-undecyl-1,2,4-oxadiazol-3-yl)acetamide (PubChem CID 101166747) has the molecular formula C15H27N3O2 and a molecular weight of 281.40 g/mol. Its IUPAC name is N-(5-undecyl-1,2,4-oxadiazol-3-yl)acetamide.
| Compound Name | N-(5-undecyl-1,2,4-oxadiazol-3-yl)acetamide |
|---|---|
| PubChem CID | 101166747 |
| Molecular Formula | C15H27N3O2 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.21 |
| IUPAC Name | N-(5-undecyl-1,2,4-oxadiazol-3-yl)acetamide |
| SMILES | CCCCCCCCCCCc1nc(NC(C)=O)no1 |
| InChI | InChI=1S/C15H27N3O2/c1-3-4-5-6-7-8-9-10-11-12-14-17-15(18-20-14)16-13(2)19/h3-12H2,1-2H3,(H,16,18,19) |
| InChIKey | UTKYIYNYJONSTP-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|