C4H7N3S — CID 82418721
(1S)-1-(1,2,4-thiadiazol-5-yl)ethanamine (PubChem CID 82418721) has the molecular formula C4H7N3S and a molecular weight of 129.19 g/mol. Its IUPAC name is (1S)-1-(1,2,4-thiadiazol-5-yl)ethanamine.
| Compound Name | (1S)-1-(1,2,4-thiadiazol-5-yl)ethanamine |
|---|---|
| PubChem CID | 82418721 |
| Molecular Formula | C4H7N3S |
| Molecular Weight | 129.19 g/mol |
| Exact Mass | 129.04 |
| IUPAC Name | (1S)-1-(1,2,4-thiadiazol-5-yl)ethanamine |
| SMILES | C[C@H](N)c1ncns1 |
| InChI | InChI=1S/C4H7N3S/c1-3(5)4-6-2-7-8-4/h2-3H,5H2,1H3/t3-/m0/s1 |
| InChIKey | OYJOFWTWITUDQR-VKHMYHEASA-N |
| XLogP | 0.56 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 129.19 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |