About 1-(4-methyl-1,3-thiazol-2-yl)ethanamine;hydrochloride
1-(4-methyl-1,3-thiazol-2-yl)ethanamine;hydrochloride (PubChem CID 73012335) has the molecular formula C6H11ClN2S
and a molecular weight of 178.69 g/mol. Its IUPAC name is 1-(4-methyl-1,3-thiazol-2-yl)ethanamine;hydrochloride.
Analyze 1-(4-methyl-1,3-thiazol-2-yl)ethanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-methyl-1,3-thiazol-2-yl)ethanamine;hydrochloride?
The IUPAC name of 1-(4-methyl-1,3-thiazol-2-yl)ethanamine;hydrochloride (CID 73012335) is 1-(4-methyl-1,3-thiazol-2-yl)ethanamine;hydrochloride.
What is the SMILES notation for 1-(4-methyl-1,3-thiazol-2-yl)ethanamine;hydrochloride?
The canonical SMILES for 1-(4-methyl-1,3-thiazol-2-yl)ethanamine;hydrochloride is Cc1csc(C(C)N)n1.Cl.
What is the InChIKey of 1-(4-methyl-1,3-thiazol-2-yl)ethanamine;hydrochloride?
The InChIKey is CSDCEDSQUNCJBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2S.ClH/c1-4-3-9-6(8-4)5(2)7;/h3,5H,7H2,1-2H3;1H.
What are the key properties of 1-(4-methyl-1,3-thiazol-2-yl)ethanamine;hydrochloride?
1-(4-methyl-1,3-thiazol-2-yl)ethanamine;hydrochloride has a molecular weight of 178.69 g/mol, XLogP of 1.89, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-methyl-1,3-thiazol-2-yl)ethanamine;hydrochloride is sourced from PubChem (CID 73012335), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).