C8H9NS — CID 143800499
2-[(2R)-but-3-yn-2-yl]-4-methyl-1,3-thiazole (PubChem CID 143800499) has the molecular formula C8H9NS and a molecular weight of 151.23 g/mol. Its IUPAC name is 2-[(2R)-but-3-yn-2-yl]-4-methyl-1,3-thiazole.
| Compound Name | 2-[(2R)-but-3-yn-2-yl]-4-methyl-1,3-thiazole |
|---|---|
| PubChem CID | 143800499 |
| Molecular Formula | C8H9NS |
| Molecular Weight | 151.23 g/mol |
| Exact Mass | 151.05 |
| IUPAC Name | 2-[(2R)-but-3-yn-2-yl]-4-methyl-1,3-thiazole |
| SMILES | C#C[C@@H](C)c1nc(C)cs1 |
| InChI | InChI=1S/C8H9NS/c1-4-6(2)8-9-7(3)5-10-8/h1,5-6H,2-3H3/t6-/m1/s1 |
| InChIKey | NUNQKDVKPGJVHY-ZCFIWIBFSA-N |
| XLogP | 2.19 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.23 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|