C7H12N2O2S — CID 174605166
azane;1-(4-methyl-1,3-thiazol-2-yl)ethyl formate (PubChem CID 174605166) has the molecular formula C7H12N2O2S and a molecular weight of 188.25 g/mol. Its IUPAC name is azane;1-(4-methyl-1,3-thiazol-2-yl)ethyl formate.
| Compound Name | azane;1-(4-methyl-1,3-thiazol-2-yl)ethyl formate |
|---|---|
| PubChem CID | 174605166 |
| Molecular Formula | C7H12N2O2S |
| Molecular Weight | 188.25 g/mol |
| Exact Mass | 188.06 |
| IUPAC Name | azane;1-(4-methyl-1,3-thiazol-2-yl)ethyl formate |
| SMILES | Cc1csc(C(C)OC=O)n1.N |
| InChI | InChI=1S/C7H9NO2S.H3N/c1-5-3-11-7(8-5)6(2)10-4-9;/h3-4,6H,1-2H3;1H3 |
| InChIKey | CDHJRXLCLMZMDH-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 74.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.25 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|