C9H15NS — CID 138644100
4-methyl-2-pentan-2-yl-1,3-thiazole (PubChem CID 138644100) has the molecular formula C9H15NS and a molecular weight of 169.29 g/mol. Its IUPAC name is 4-methyl-2-pentan-2-yl-1,3-thiazole.
| Compound Name | 4-methyl-2-pentan-2-yl-1,3-thiazole |
|---|---|
| PubChem CID | 138644100 |
| Molecular Formula | C9H15NS |
| Molecular Weight | 169.29 g/mol |
| Exact Mass | 169.09 |
| IUPAC Name | 4-methyl-2-pentan-2-yl-1,3-thiazole |
| SMILES | CCCC(C)c1nc(C)cs1 |
| InChI | InChI=1S/C9H15NS/c1-4-5-7(2)9-10-8(3)6-11-9/h6-7H,4-5H2,1-3H3 |
| InChIKey | OGLQBNPNFHZVCX-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.29 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |