C13H15NS — CID 21365787
4-methyl-2-(1-phenylpropan-2-yl)-1,3-thiazole (PubChem CID 21365787) has the molecular formula C13H15NS and a molecular weight of 217.34 g/mol. Its IUPAC name is 4-methyl-2-(1-phenylpropan-2-yl)-1,3-thiazole.
| Compound Name | 4-methyl-2-(1-phenylpropan-2-yl)-1,3-thiazole |
|---|---|
| PubChem CID | 21365787 |
| Molecular Formula | C13H15NS |
| Molecular Weight | 217.34 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | 4-methyl-2-(1-phenylpropan-2-yl)-1,3-thiazole |
| SMILES | Cc1csc(C(C)Cc2ccccc2)n1 |
| InChI | InChI=1S/C13H15NS/c1-10(13-14-11(2)9-15-13)8-12-6-4-3-5-7-12/h3-7,9-10H,8H2,1-2H3 |
| InChIKey | PZZRRNGCODQSCK-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.34 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |