C9H15NO2S2 — CID 163565018
4-methyl-2-(4-methylsulfonylbutan-2-yl)-1,3-thiazole (PubChem CID 163565018) has the molecular formula C9H15NO2S2 and a molecular weight of 233.36 g/mol. Its IUPAC name is 4-methyl-2-(4-methylsulfonylbutan-2-yl)-1,3-thiazole.
| Compound Name | 4-methyl-2-(4-methylsulfonylbutan-2-yl)-1,3-thiazole |
|---|---|
| PubChem CID | 163565018 |
| Molecular Formula | C9H15NO2S2 |
| Molecular Weight | 233.36 g/mol |
| Exact Mass | 233.05 |
| IUPAC Name | 4-methyl-2-(4-methylsulfonylbutan-2-yl)-1,3-thiazole |
| SMILES | Cc1csc(C(C)CCS(C)(=O)=O)n1 |
| InChI | InChI=1S/C9H15NO2S2/c1-7(4-5-14(3,11)12)9-10-8(2)6-13-9/h6-7H,4-5H2,1-3H3 |
| InChIKey | FULRYTLBBPEXDT-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.36 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |