C7H11NOS — CID 124594880
(1R)-1-(4-methyl-1,3-thiazol-2-yl)propan-1-ol (PubChem CID 124594880) has the molecular formula C7H11NOS and a molecular weight of 157.24 g/mol. Its IUPAC name is (1R)-1-(4-methyl-1,3-thiazol-2-yl)propan-1-ol.
| Compound Name | (1R)-1-(4-methyl-1,3-thiazol-2-yl)propan-1-ol |
|---|---|
| PubChem CID | 124594880 |
| Molecular Formula | C7H11NOS |
| Molecular Weight | 157.24 g/mol |
| Exact Mass | 157.06 |
| IUPAC Name | (1R)-1-(4-methyl-1,3-thiazol-2-yl)propan-1-ol |
| SMILES | CC[C@@H](O)c1nc(C)cs1 |
| InChI | InChI=1S/C7H11NOS/c1-3-6(9)7-8-5(2)4-10-7/h4,6,9H,3H2,1-2H3/t6-/m1/s1 |
| InChIKey | JOHPQMMQKTZFAZ-ZCFIWIBFSA-N |
| XLogP | 1.89 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.24 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |