C13H23NOS — CID 104769579
3-ethyl-1-(4-methyl-1,3-thiazol-2-yl)heptan-1-ol (PubChem CID 104769579) has the molecular formula C13H23NOS and a molecular weight of 241.40 g/mol. Its IUPAC name is 3-ethyl-1-(4-methyl-1,3-thiazol-2-yl)heptan-1-ol.
| Compound Name | 3-ethyl-1-(4-methyl-1,3-thiazol-2-yl)heptan-1-ol |
|---|---|
| PubChem CID | 104769579 |
| Molecular Formula | C13H23NOS |
| Molecular Weight | 241.40 g/mol |
| Exact Mass | 241.15 |
| IUPAC Name | 3-ethyl-1-(4-methyl-1,3-thiazol-2-yl)heptan-1-ol |
| SMILES | CCCCC(CC)CC(O)c1nc(C)cs1 |
| InChI | InChI=1S/C13H23NOS/c1-4-6-7-11(5-2)8-12(15)13-14-10(3)9-16-13/h9,11-12,15H,4-8H2,1-3H3 |
| InChIKey | NXFHONKRTVIUPB-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.40 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |